CAS 857629-79-9
:(2E)-2-Cyano-3-(3-ethoxy-4-hydroxy-5-nitrophenyl)-N,N-diethyl-2-propenamide
Description:
(2E)-2-Cyano-3-(3-ethoxy-4-hydroxy-5-nitrophenyl)-N,N-diethyl-2-propenamide is a synthetic organic compound characterized by its complex structure, which includes a cyano group, an amide functional group, and a substituted phenyl ring. The presence of the cyano group indicates potential reactivity, particularly in nucleophilic addition reactions. The ethoxy and hydroxy groups contribute to its solubility and polarity, while the nitro group can enhance its electronic properties, making it useful in various chemical applications. This compound may exhibit biological activity due to its structural features, which could interact with biological targets. Its amide linkage suggests potential for hydrogen bonding, influencing its physical properties such as melting point and solubility. Additionally, the diethyl substitution on the nitrogen atom may affect its steric hindrance and overall reactivity. Overall, this compound's unique combination of functional groups positions it as a candidate for further research in medicinal chemistry or material science.
Formula:C16H19N3O5
InChI:InChI=1S/C16H19N3O5/c1-4-18(5-2)16(21)12(10-17)7-11-8-13(19(22)23)15(20)14(9-11)24-6-3/h7-9,20H,4-6H2,1-3H3/b12-7+
InChI key:InChIKey=FGJZUPPLPIHQSE-KPKJPENVSA-N
SMILES:C(=C(/C(N(CC)CC)=O)\C#N)\C1=CC(OCC)=C(O)C(N(=O)=O)=C1
Synonyms:- (2E)-2-Cyano-3-(3-ethoxy-4-hydroxy-5-nitrophenyl)-N,N-diethyl-2-propenamide
- 2-Propenamide, 2-cyano-3-(3-ethoxy-4-hydroxy-5-nitrophenyl)-N,N-diethyl-, (2E)-
- (2E)-2-Cyano-3-(3-ethoxy-4-hydroxy-
- (E)-2-cyano-3-(3-ethoxy-4-hydroxy-5-nitrophenyl)-N,N-diethylprop-2-enamide
- Entacapone Impurity 20(Entacapone EP Impurity D)
- (E)-2-cyano-3-(3-ethoxy-4-hydroxy-5-nitrophenyl)-N,N-diethylacrylamide
- Entacapone Impurity 4(Entacapone EP Impurity D)
- Entacapone impurity D
- Entacapone Impurity 4(Entacapone EP Impurity A)
- Imp. D (EP):(2E)-2-Cyano-3-(3-ethoxy-4-hydroxy-5-nitrophenyl)-N,N-diethylprop-2-enamide
- (E)-N,N-diethyl-2-cyano-3-(3-ethoxy-4-hydroxy-5-nitrophenyl)acrylamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
(2E)-2-Cyano-3-(3-ethoxy-4-hydroxy-5-nitrophenyl)-N,N-diethyl-2-propenamide
CAS:Controlled ProductApplications (2E)-2-Cyano-3-(3-ethoxy-4-hydroxy-5-nitrophenyl)-N,N-diethyl-2-propenamide is an impurity of Entacapone (E558500), a peripherally acting inhibitor of catechol-O-methyl transferase (COMT), an enzyme involved in the metabolism of catecholamine neurotransmitters and related drugs. Antiparkinsonian.
References Karlsson, M., et al.: J. Pharm. Biomed. Anal., 10, 593 (1992), Nissinen, E., et al.: Arch. Pharmacol., 346, 262 (1992), Wikberg, T., et al.: Eur. J. Drug Metab. Pharmacokinet., 18, 359 (1993),Formula:C16H19N3O5Color and Shape:NeatMolecular weight:333.34



