
CAS 857637-01-5
:3-Hydroxy-1-pyrrolidineacetonitrile
Description:
3-Hydroxy-1-pyrrolidineacetonitrile, with the CAS number 857637-01-5, is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This compound features a hydroxyl group (-OH) and a nitrile group (-C≡N) attached to the acetonitrile moiety, contributing to its unique reactivity and properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the hydroxyl group suggests potential for hydrogen bonding, which can influence its solubility in polar solvents. The nitrile group may impart certain polar characteristics, making it useful in various chemical reactions, including nucleophilic additions. This compound may be of interest in medicinal chemistry and organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Safety data should be consulted for handling, as compounds with nitrile groups can be toxic or hazardous. Overall, 3-Hydroxy-1-pyrrolidineacetonitrile is a versatile compound with potential applications in various fields of chemistry.
Formula:C6H10N2O
InChI:InChI=1S/C6H10N2O/c7-2-4-8-3-1-6(9)5-8/h6,9H,1,3-5H2
InChI key:InChIKey=ZJKMVVGNSMLLAV-UHFFFAOYSA-N
SMILES:C(C#N)N1CC(O)CC1
Synonyms:- (3-Hydroxypyrrolidin-1-yl)acetonitrile
- 3-Hydroxy-1-pyrrolidineacetonitrile
- 2-(3-Hydroxypyrrolidin-1-yl)acetonitrile
- 1-Pyrrolidineacetonitrile, 3-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.