CAS 857637-03-7

[1-(2-aminoethyl)-3-piperidyl]methanol

Description:

[1-(2-aminoethyl)-3-piperidyl]methanol, with the CAS number 857637-03-7, is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features an aminoethyl side chain and a hydroxymethyl group, contributing to its potential as a bioactive molecule. It is typically a white to off-white solid at room temperature and is soluble in polar solvents due to the presence of the hydroxyl group. The amino group can participate in hydrogen bonding, enhancing its solubility and reactivity. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of drugs targeting neurological or psychiatric conditions. Its structure allows for interactions with various biological targets, and it may also serve as a building block for more complex molecules in synthetic organic chemistry. As with many amines, it may be sensitive to oxidation and should be handled with care in a controlled environment.

Formula: C₈H₁₈N₂O

InChI: InChI=1/C8H18N2O/c9-3-5-10-4-1-2-8(6-10)7-11/h8,11H,1-7,9H2

SMILES: C1CC(CN(C1)CCN)CO

[1-(2-Amino-ethyl)-piperidin-3-yl]-methanol

CAS: 857637-03-7

Formula: C₈H₁₈N₂O

Purity: 95.0%

Color and Shape: Liquid, No data available.

Molecular weight: 158.245

Ref: 10-F082631