CAS 857637-07-1

1-(2-aminoethyl)pyrrolidin-3-ol

Description:

1-(2-Aminoethyl)pyrrolidin-3-ol, with the CAS number 857637-07-1, is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring substituted with an aminoethyl group and a hydroxyl group. This compound is classified as an amino alcohol, which typically exhibits properties such as being a polar molecule due to the presence of both amino and hydroxyl functional groups. These functional groups contribute to its potential solubility in water and other polar solvents. The presence of the amino group suggests that it may participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its structural features may allow it to interact with various biological targets, potentially leading to applications in drug development. Overall, 1-(2-aminoethyl)pyrrolidin-3-ol is a compound with notable chemical properties that warrant further investigation for its potential uses in various fields.

Formula: C₆H₁₄N₂O

InChI: InChI=1/C6H14N2O/c7-2-4-8-3-1-6(9)5-8/h6,9H,1-5,7H2

SMILES: C1CN(CCN)CC1O

Synonyms:

• 1-(2-aminoethyl)pyrrolidin-3-ol
• 3-Pyrrolidinol, 1-(2-aminoethyl)-
• 2-(3-Hydroxy-1-pyrrolidinyl)ethylamine
• 1-(2-aMinoethyl)-3-Pyrrolidinol

1-(2-Aminoethyl)pyrrolidin-3-ol

CAS: 857637-07-1

Formula: C₆H₁₄N₂O

Purity: 95%

Molecular weight: 130.1882

Ref: IN-DA004RZ2

1-(2-Aminoethyl)pyrrolidin-3-ol

CAS: 857637-07-1

1-(2-Aminoethyl)pyrrolidin-3-ol

Purity: 95%

Molecular weight: 130.19g/mol

Ref: 54-OR315574

1-(2-Aminoethyl)-3-pyrrolidinol

CAS: 857637-07-1

Please enquire for more information about 1-(2-Aminoethyl)-3-pyrrolidinol including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₆H₁₄N₂O

Purity: 90%Min

Color and Shape: Clear Liquid

Molecular weight: 130.19 g/mol

Ref: 3D-FA45661