CAS 857652-30-3: 1,1-Dimethylethyl 4-[[3-(4-pyridinyl)-1,2,4-oxadiazol-5-yl]methoxy]-1-piperidinecarboxylate

Description:1,1-Dimethylethyl 4-[[3-(4-pyridinyl)-1,2,4-oxadiazol-5-yl]methoxy]-1-piperidinecarboxylate, with CAS number 857652-30-3, is a chemical compound characterized by its complex structure, which includes a piperidine ring, a pyridine moiety, and an oxadiazole group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the oxadiazole and pyridine rings suggests possible interactions with biological targets, which may contribute to its pharmacological effects. Additionally, the dimethyl group enhances lipophilicity, potentially influencing its absorption and distribution in biological systems. The compound's synthesis and characterization would involve standard organic chemistry techniques, including NMR and mass spectrometry for structural confirmation. Overall, this compound represents a class of heterocyclic compounds that may have applications in medicinal chemistry, particularly in the development of new therapeutic agents.

Formula:C₁₈H₂₄N₄O₄

InChI:InChI=1S/C18H24N4O4/c1-18(2,3)25-17(23)22-10-6-14(7-11-22)24-12-15-20-16(21-26-15)13-4-8-19-9-5-13/h4-5,8-9,14H,6-7,10-12H2,1-3H3

InChI key:InChIKey=LHZWKWCEAXQUMX-UHFFFAOYSA-N

SMILES:O=C(OC(C)(C)C)N1CCC(OCC2=NC(=NO2)C=3C=CN=CC3)CC1

Synonyms:
PSN 632408
1,1-Dimethylethyl 4-[[3-(4-pyridinyl)-1,2,4-oxadiazol-5-yl]methoxy]-1-piperidinecarboxylate
1-Piperidinecarboxylic acid, 4-[[3-(4-pyridinyl)-1,2,4-oxadiazol-5-yl]methoxy]-, 1,1-dimethylethyl ester

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	PSN632408 REF: TM-T16678CAS: 857652-30-3	98%	41.00 €	Fri 25 Apr 25
	Tert-Butyl 4-((3-(pyridin-4-yl)-1,2,4-oxadiazol-5-yl)methoxy)piperidine-1-carboxylate REF: 3D-HJB65230CAS: 857652-30-3	Min. 95%	To inquire	Tue 10 Jun 25