CAS 857653-94-2

[3-(4-pyridyl)-1,2,4-oxadiazol-5-yl]methanol

Description:

[3-(4-pyridyl)-1,2,4-oxadiazol-5-yl]methanol is a chemical compound characterized by its unique structure, which includes a pyridine ring and an oxadiazole moiety. The presence of the pyridyl group contributes to its potential as a ligand in coordination chemistry and its ability to participate in hydrogen bonding due to the nitrogen atoms in the ring. The oxadiazole part of the molecule is known for its stability and can exhibit interesting electronic properties, making it relevant in materials science and medicinal chemistry. The hydroxymethyl group (-CH2OH) enhances its solubility in polar solvents and may also contribute to its reactivity, allowing for further functionalization. This compound may exhibit biological activity, which is often explored in drug discovery contexts. Its specific applications and properties can vary based on the context of use, including potential roles in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. As with many chemical substances, safety data and handling precautions should be considered when working with this compound.

Formula: C₈H₇N₃O₂

InChI: InChI=1/C8H7N3O2/c12-5-7-10-8(11-13-7)6-1-3-9-4-2-6/h1-4,12H,5H2

SMILES: c1cnccc1c1nc(CO)on1