CAS 857653-98-6

1,1-Dimethylethyl 4-[2-(hydroxyamino)-2-iminoethoxy]-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 4-[2-(hydroxyamino)-2-iminoethoxy]-1-piperidinecarboxylate, identified by its CAS number 857653-98-6, is a chemical compound that features a piperidine ring, which is a six-membered nitrogen-containing heterocycle. This compound is characterized by the presence of a tert-butyl group (1,1-dimethylethyl) and a hydroxyamino group, indicating potential reactivity and biological activity. The iminoethoxy moiety suggests that it may participate in various chemical reactions, including nucleophilic attacks or condensation reactions. The presence of the carboxylate group implies that it may exhibit acidic properties, influencing its solubility and interaction with other molecules. This compound may be of interest in medicinal chemistry due to its structural features, which could contribute to its pharmacological properties. However, specific details regarding its stability, solubility, and biological activity would require further investigation through experimental studies. Overall, this compound represents a complex structure with potential applications in various fields, including pharmaceuticals and organic synthesis.

Formula: C₁₂H₂₃N₃O₄

InChI: InChI=1S/C12H23N3O4/c1-12(2,3)19-11(16)15-6-4-9(5-7-15)18-8-10(13)14-17/h9,17H,4-8H2,1-3H3,(H2,13,14)

InChI key: InChIKey=JOMWMDCZYGEZKT-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CCC(OCC(NO)=N)CC1

Synonyms:

• 1-Piperidinecarboxylic acid, 4-[2-(hydroxyamino)-2-iminoethoxy]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 4-[2-(hydroxyamino)-2-iminoethoxy]-1-piperidinecarboxylate