
CAS 85769-44-4
:5,8,9,15a-Tetrahydro-3,4-dimethoxy[1,3]dioxolo[4,5-h]isoquino[1,2-b][3]benzazepine-6,15-dione
Description:
5,8,9,15a-Tetrahydro-3,4-dimethoxy[1,3]dioxolo[4,5-h]isoquino[1,2-b][3]benzazepine-6,15-dione is a complex organic compound characterized by its unique bicyclic structure, which incorporates both isoquinoline and benzazepine moieties. This compound features multiple functional groups, including methoxy and dioxole groups, contributing to its chemical reactivity and potential biological activity. The presence of the dione functional groups suggests that it may participate in various chemical reactions, such as nucleophilic additions or cycloadditions. Its structural complexity may also influence its solubility, stability, and interaction with biological targets. Compounds of this nature are often investigated for their pharmacological properties, including potential applications in medicinal chemistry. However, specific data regarding its biological activity, toxicity, and practical applications may require further research and exploration. Overall, this compound exemplifies the intricate nature of organic chemistry and the diverse possibilities within the realm of synthetic organic compounds.
Formula:C21H19NO6
InChI:InChI=1S/C21H19NO6/c1-25-15-4-3-12-14(21(15)26-2)9-18(23)22-6-5-11-7-16-17(28-10-27-16)8-13(11)20(24)19(12)22/h3-4,7-8,19H,5-6,9-10H2,1-2H3
InChI key:InChIKey=RIGDPEKYCIWKDD-UHFFFAOYSA-N
SMILES:O=C1C2C=3C(=C(OC)C(OC)=CC3)CC(=O)N2CCC=4C1=CC5=C(C4)OCO5
Synonyms:- NSC 380855
- [1,3]Dioxolo[4,5-h]isoquino[1,2-b][3]benzazepine-6,15-dione, 5,8,9,15a-tetrahydro-3,4-dimethoxy-
- 5,8,9,15a-Tetrahydro-3,4-dimethoxy[1,3]dioxolo[4,5-h]isoquino[1,2-b][3]benzazepine-6,15-dione
- Puntarenine
- [1,3]Dioxolo[4,5-h]isoquino[1,2-b][3]benzazepine-6,15-dione, 5,8,9,15a-tetrahydro-3,4-dimethoxy-, (±)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Puntarenine
CAS:Puntarenine, an isohomoprotoberberine alkaloid, mildly inhibits Trichophyton mentagrophytes and Saccharomyces cerevisiae.Formula:C21H19NO6Color and Shape:SolidMolecular weight:381.38
