CAS 857724-35-7
:2-Isopropylamino-3'-methoxyacetophenone
Description:
2-Isopropylamino-3'-methoxyacetophenone, identified by its CAS number 857724-35-7, is an organic compound that belongs to the class of acetophenones. This substance features a methoxy group (-OCH3) and an isopropylamino group (-NH(isopropyl)) attached to the aromatic ring, which contributes to its unique chemical properties. It typically appears as a solid or crystalline substance and is characterized by its moderate solubility in organic solvents. The presence of the methoxy group can influence its reactivity and polarity, while the isopropylamino group may impart basic properties. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and utility in synthesizing other chemical entities. As with many organic compounds, safety precautions should be observed when handling it, including the use of appropriate personal protective equipment, as its specific toxicity and environmental impact may not be fully characterized.
Formula:C12H17NO2
InChI:InChI=1/C12H17NO2/c1-9(2)13-8-12(14)10-5-4-6-11(7-10)15-3/h4-7,9,13H,8H2,1-3H3
SMILES:CC(C)NCC(=O)c1cccc(c1)OC
Synonyms:- Ethanone, 1-(3-Methoxyphenyl)-2-[(1-Methylethyl)Amino]-
- 2-(Isopropylamino)-1-(3-Methoxyphenyl)Ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

