CAS 857891-82-8

26-azido-3,6,9,12,15,18,21,24-octaoxahexacosan-1-amine

Description:

26-Azido-3,6,9,12,15,18,21,24-octaoxahexacosan-1-amine is a synthetic organic compound characterized by its long carbon chain and multiple ether linkages, indicated by the presence of eight oxygen atoms in its structure. The azido group (-N3) is a notable feature, which can impart unique reactivity, particularly in click chemistry applications. This compound is likely to be soluble in polar solvents due to its hydrophilic ether groups, while the long hydrocarbon chain may provide some lipophilicity. The presence of the amine functional group suggests potential for further chemical modifications, such as coupling reactions. Its structural complexity and functional groups make it of interest in various fields, including materials science and medicinal chemistry, where it may serve as a precursor for more complex molecules or as a component in drug delivery systems. Safety considerations should be taken into account due to the azido group, which can be sensitive and potentially explosive under certain conditions.

Formula: C₁₈H₃₈N₄O₈

InChI: InChI=1/C18H38N4O8/c19-1-3-23-5-7-25-9-11-27-13-15-29-17-18-30-16-14-28-12-10-26-8-6-24-4-2-21-22-20/h1-19H2

SMILES: C(COCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[NH-])N

O-(2-Aminoethyl)-O′-(2-azidoethyl)heptaethylene glycol

CAS: 857891-82-8

Formula: C₁₈H₃₈N₄O₈

Purity: 97%

Color and Shape: Liquid

Molecular weight: 438.5163

Ref: IN-DA0035F5

Azido-PEG8-amine

CAS: 857891-82-8

Azido-PEG8-amine

Formula: C₁₈H₃₈N₄O₈

Purity: 96% (Typical Value in Batch COA)

Color and Shape: liquid

Molecular weight: 438.52g/mol

Ref: 54-BIPG1131

O-(2-Aminoethyl)-O'-(2-azidoethyl)heptaethylene glycol

CAS: 857891-82-8

O-(2-Aminoethyl)-O'-(2-azidoethyl)heptaethylene glycol is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. O-(2-Aminoethyl)-O'-(2-azidoethyl)heptaethylene glycol is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.

Formula: C₁₈H₃₈N₄O₈

Purity: Min. 95%

Color and Shape: Colorless Powder

Molecular weight: 438.52 g/mol

Ref: 3D-FA58141

Azido-PEG8-amine

CAS: 857891-82-8

Purity: 97%

Molecular weight: 438.27

Ref: 10-F554739

Azido-PEG8-amine

CAS: 857891-82-8

Azido-PEG8-amine, a PEG-based linker for PROTACs, joins two essential ligands crucial for forming PROTAC molecules, enabling selective protein degradation by leveraging the ubiquitin-proteasome system within cells.

Formula: C₁₈H₃₈N₄O₈

Purity: 98%

Color and Shape: Solid

Molecular weight: 438.52

Ref: TM-T14474