CymitQuimica logo

CAS 857891-83-9

:

1,1-Dimethylethyl 42-azido-8,15-dioxo-19,22,25,28,31,34,37,40-octaoxa-2,9,16-triazadotetracontanoate

Description:
1,1-Dimethylethyl 42-azido-8,15-dioxo-19,22,25,28,31,34,37,40-octaoxa-2,9,16-triazadotetracontanoate, with CAS number 857891-83-9, is a complex organic compound characterized by its unique structural features, including multiple functional groups and a long carbon chain. The presence of azido (-N3) groups suggests potential reactivity, particularly in click chemistry or as a precursor for further chemical transformations. The dioxo groups indicate the presence of carbonyl functionalities, which can influence the compound's reactivity and stability. The octaoxa and triazadato moieties contribute to the compound's overall polarity and solubility characteristics, potentially making it soluble in polar solvents. This compound may exhibit interesting biological or chemical properties due to its intricate structure, making it a candidate for various applications in materials science, medicinal chemistry, or as a synthetic intermediate. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C35H68N6O12
InChI:InChI=1S/C35H68N6O12/c1-35(2,3)53-34(44)39-13-9-5-7-10-32(42)37-12-8-4-6-11-33(43)38-14-16-45-18-20-47-22-24-49-26-28-51-30-31-52-29-27-50-25-23-48-21-19-46-17-15-40-41-36/h4-31H2,1-3H3,(H,37,42)(H,38,43)(H,39,44)
InChI key:InChIKey=ZHDHDJFGNAMBNV-UHFFFAOYSA-N
SMILES:N(CCCCCC(NCCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-])=O)C(CCCCCNC(OC(C)(C)C)=O)=O
Synonyms:
  • 19,22,25,28,31,34,37,40-Octaoxa-2,9,16-triazadotetracontanoic acid, 42-azido-8,15-dioxo-, 1,1-dimethylethyl ester
  • 1,1-Dimethylethyl 42-azido-8,15-dioxo-19,22,25,28,31,34,37,40-octaoxa-2,9,16-triazadotetracontanoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.