CymitQuimica logo

CAS 857893-09-5

:

1-Butyl-1H-indol-5-amine

Description:
1-Butyl-1H-indol-5-amine, identified by its CAS number 857893-09-5, is a chemical compound that features an indole structure substituted with a butyl group and an amine functional group. This compound is characterized by its aromatic indole ring, which contributes to its potential biological activity, particularly in medicinal chemistry. The presence of the butyl group enhances its lipophilicity, potentially influencing its pharmacokinetic properties, such as absorption and distribution in biological systems. The amine group can participate in hydrogen bonding, which may affect its interactions with biological targets. Compounds like 1-butyl-1H-indol-5-amine are often studied for their potential roles in drug development, particularly in the context of neurological or psychiatric disorders, due to the indole moiety's structural similarity to neurotransmitters. Additionally, the compound's stability, solubility, and reactivity can vary based on environmental conditions, making it a subject of interest in both synthetic and medicinal chemistry research.
Formula:C12H16N2
InChI:InChI=1S/C12H16N2/c1-2-3-7-14-8-6-10-9-11(13)4-5-12(10)14/h4-6,8-9H,2-3,7,13H2,1H3
InChI key:InChIKey=URQOCXDBXNKKQJ-UHFFFAOYSA-N
SMILES:C(CCC)N1C=2C(=CC(N)=CC2)C=C1
Synonyms:
  • 1H-Indol-5-amine, 1-butyl-
  • 1-Butyl-1H-indol-5-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.