CAS 857898-70-5

tert-Butyl 1H-spiro[isoquinoline-4,4'-piperidine]-2(3H)-carboxylate

Description:

Tert-Butyl 1H-spiro[isoquinoline-4,4'-piperidine]-2(3H)-carboxylate is a complex organic compound characterized by its unique spirocyclic structure, which combines an isoquinoline moiety with a piperidine ring. This compound typically features a tert-butyl ester functional group, contributing to its solubility and stability. The spiro arrangement indicates that the compound has two rings that share a single atom, which can influence its chemical reactivity and biological activity. The presence of the carboxylate group suggests potential for interactions in various chemical environments, making it a candidate for applications in medicinal chemistry and drug development. Its molecular structure may exhibit chirality, leading to different stereoisomers with potentially varying biological effects. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and solvents used. Overall, tert-Butyl 1H-spiro[isoquinoline-4,4'-piperidine]-2(3H)-carboxylate represents a class of compounds that may possess interesting pharmacological properties due to their structural complexity.

Formula: C₁₈H₂₆N₂O₂

InChI: InChI=1/C18H26N2O2/c1-17(2,3)22-16(21)20-12-14-6-4-5-7-15(14)18(13-20)8-10-19-11-9-18/h4-7,19H,8-13H2,1-3H3

SMILES: CC(C)(C)OC(=O)N1Cc2ccccc2C2(CCNCC2)C1

tert-Butyl 1H-spiro[isoquinoline-4,4'-piperidine]-2(3H)-carboxylate

CAS: 857898-70-5

Formula: C₁₈H₂₆N₂O₂

Color and Shape: Solid

Molecular weight: 302.4112

Ref: IN-DA003UJ2

tert-Butyl 1H-spiro[isoquinoline-4,4'-piperidine]-2(3H)-carboxylate

CAS: 857898-70-5

tert-Butyl 1H-spiro[isoquinoline-4,4'-piperidine]-2(3H)-carboxylate

Purity: ≥95%

Molecular weight: 302.41g/mol

Ref: 54-OR315561