CAS 85791-77-1
:N-(2-amino-2-oxoethyl)propan-2-aminium
Description:
N-(2-amino-2-oxoethyl)propan-2-aminium, also known by its CAS number 85791-77-1, is a chemical compound characterized by its aminium functional group, which indicates the presence of a positively charged nitrogen atom. This compound features an amino group (-NH2) and a carbonyl group (C=O) adjacent to the nitrogen, contributing to its reactivity and potential biological activity. It is typically soluble in polar solvents due to its ionic nature, which enhances its interaction with water and other polar molecules. The presence of both amino and carbonyl functionalities suggests that it may participate in various chemical reactions, such as nucleophilic attacks or condensation reactions. This compound may also exhibit properties relevant to biological systems, potentially acting as a precursor or intermediate in the synthesis of pharmaceuticals or other biologically active molecules. Its stability and reactivity can be influenced by pH and temperature, making it important to consider these factors in practical applications.
Formula:C5H13N2O
InChI:InChI=1/C5H12N2O/c1-4(2)7-3-5(6)8/h4,7H,3H2,1-2H3,(H2,6,8)/p+1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
