CymitQuimica logo

CAS 857934-83-9

:

4,4,5,5-Tetramethyl-2-[4-(2-propen-1-yl)phenyl]-1,3,2-dioxaborolane

Description:
4,4,5,5-Tetramethyl-2-[4-(2-propen-1-yl)phenyl]-1,3,2-dioxaborolane is an organoboron compound characterized by its unique dioxaborolane structure, which features a boron atom bonded to two oxygen atoms and a carbon framework. This compound typically exhibits a high degree of stability due to the presence of the boron-oxygen bond, making it useful in various chemical applications, particularly in organic synthesis and materials science. The presence of the tetramethyl groups enhances its solubility and reactivity, while the propenyl-substituted phenyl group contributes to its potential as a building block in polymer chemistry and as a ligand in coordination chemistry. Additionally, the compound may exhibit interesting optical properties, making it suitable for applications in photonic devices. Its reactivity can be influenced by the presence of functional groups, allowing for further derivatization. Overall, this compound represents a versatile intermediate in synthetic organic chemistry, with potential applications in pharmaceuticals and advanced materials.
Formula:C15H21BO2
InChI:InChI=1S/C15H21BO2/c1-6-7-12-8-10-13(11-9-12)16-17-14(2,3)15(4,5)18-16/h6,8-11H,1,7H2,2-5H3
InChI key:InChIKey=FUQIBDUEQXZBEY-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CC=C(CC=C)C=C2
Synonyms:
  • 4,4,5,5-Tetramethyl-2-[4-(2-propen-1-yl)phenyl]-1,3,2-dioxaborolane
  • 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-[4-(2-propenyl)phenyl]-
  • 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-[4-(2-propen-1-yl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.