
CAS 857934-95-3
:8-Quinolinol, 5-iodo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, 8-(4-methylbenzenesulfonate)
Description:
8-Quinolinol, 5-iodo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, 8-(4-methylbenzenesulfonate) is a complex organic compound characterized by its quinoline core, which is a bicyclic structure containing a nitrogen atom. The presence of the iodine substituent at the 5-position enhances its reactivity and potential applications in various chemical reactions, including coupling reactions in organic synthesis. The 4,4,5,5-tetramethyl-1,3,2-dioxaborolane moiety contributes to its boron content, which is often utilized in cross-coupling reactions, making it valuable in the synthesis of complex organic molecules. Additionally, the 8-(4-methylbenzenesulfonate) group serves as a leaving group, facilitating nucleophilic substitution reactions. This compound may exhibit properties such as solubility in organic solvents and potential biological activity, which could be explored in medicinal chemistry. Overall, its unique structural features suggest utility in synthetic organic chemistry and possibly in pharmaceutical applications.
Formula:C22H23BINO5S
InChI:InChI=1S/C22H23BINO5S/c1-14-8-10-15(11-9-14)31(26,27)28-20-17(23-29-21(2,3)22(4,5)30-23)13-18(24)16-7-6-12-25-19(16)20/h6-13H,1-5H3
InChI key:InChIKey=XOFIVANMPFQFAT-UHFFFAOYSA-N
SMILES:O(S(=O)(=O)C1=CC=C(C)C=C1)C2=C(C=C(I)C3=C2N=CC=C3)B4OC(C)(C)C(C)(C)O4
Synonyms:- 8-Quinolinol, 5-iodo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, 4-methylbenzenesulfonate (ester)
- 8-Quinolinol, 5-iodo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, 8-(4-methylbenzenesulfonate)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
8-Quinolinol, 5-iodo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, 8-(4-methylbenzenesulfonate)
CAS:Formula:C22H23BINO5SMolecular weight:551.2022
