CymitQuimica logo

CAS 857934-97-5

:

1-[1-(Phenylsulfonyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-3-yl]-1-propanone

Description:
1-[1-(Phenylsulfonyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-3-yl]-1-propanone, with CAS number 857934-97-5, is a complex organic compound characterized by its unique structural features. It contains an indole moiety, which is known for its aromatic properties and biological significance. The presence of a phenylsulfonyl group enhances its reactivity and solubility in various organic solvents. Additionally, the incorporation of a boron-containing dioxaborolane unit suggests potential applications in organoboron chemistry, particularly in cross-coupling reactions and as a reagent in organic synthesis. The compound's ketone functional group contributes to its electrophilic character, making it a candidate for further chemical transformations. Overall, this substance exhibits properties that may be valuable in medicinal chemistry and materials science, although specific applications would depend on further research and characterization. Its stability, solubility, and reactivity profile would be essential for determining its utility in various chemical contexts.
Formula:C23H26BNO5S
InChI:InChI=1S/C23H26BNO5S/c1-6-19(26)20-17-14-10-11-15-18(17)25(31(27,28)16-12-8-7-9-13-16)21(20)24-29-22(2,3)23(4,5)30-24/h7-15H,6H2,1-5H3
InChI key:InChIKey=ORSMJQLMGQQCOO-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1C(=C(C(CC)=O)C=2C1=CC=CC2)B3OC(C)(C)C(C)(C)O3)C4=CC=CC=C4
Synonyms:
  • 1H-Indole, 3-(1-oxopropyl)-1-(phenylsulfonyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • 1-[1-(Phenylsulfonyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-3-yl]-1-propanone
  • 1-Propanone, 1-[1-(phenylsulfonyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-3-yl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.