CAS 857969-66-5

5-Bromothiazolo[5,4-b]pyridine

Description:

5-Bromothiazolo[5,4-b]pyridine is a heterocyclic compound characterized by the presence of both bromine and a thiazole-pyridine structure. This compound features a fused bicyclic system that incorporates a thiazole ring and a pyridine ring, contributing to its unique chemical properties. The bromine atom, which is a halogen, typically enhances the compound's reactivity and can influence its biological activity. 5-Bromothiazolo[5,4-b]pyridine is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The compound may exhibit various properties such as solubility in organic solvents, and its reactivity can be influenced by the presence of the bromine substituent. Additionally, its structural features may allow for specific interactions with enzymes or receptors, making it a candidate for further research in drug discovery and development. As with many heterocycles, the compound's stability and reactivity can vary based on environmental conditions and the presence of other functional groups.

Formula: C₆H₃BrN₂S

InChI: InChI=1S/C6H3BrN2S/c7-5-2-1-4-6(9-5)10-3-8-4/h1-3H

InChI key: InChIKey=AFGZXGZVCNYHHJ-UHFFFAOYSA-N

SMILES: BrC=1N=C2C(=CC1)N=CS2

Synonyms:

• 5-Bromothiazolo[5,4-b]pyridine
• Thiazolo[5,4-b]pyridine, 5-bromo-

5-bromo-thiazolo[5,4-b]pyridine

CAS: 857969-66-5

Formula: C₆H₃BrN₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 215.0704

Ref: IN-DA00GN19

Thiazolo[5,4-b]pyridine, 5-bromo-

CAS: 857969-66-5

Thiazolo[5,4-b]pyridine, 5-bromo-

Purity: 97%

Molecular weight: 215.07g/mol

Ref: 54-OR82620

Thiazolo[5,4-b]pyridine, 5-bromo-

CAS: 857969-66-5

Purity: 95%

Molecular weight: 215.0700073

Ref: 10-F690375