CAS 85798-96-5

6-hydroxy-8-[2-(4-hydroxy-6-oxotetrahydro-2H-pyran-2-yl)ethyl]-7-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl 2-methylbutanoate

Description:

6-hydroxy-8-[2-(4-hydroxy-6-oxotetrahydro-2H-pyran-2-yl)ethyl]-7-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl 2-methylbutanoate, with CAS number 85798-96-5, is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as hydroxyl, ester, and ketone functionalities. This compound features a hexahydronaphthalene core, contributing to its hydrophobic characteristics, while the presence of the tetrahydropyran moiety introduces additional polarity and potential for hydrogen bonding. The compound's molecular architecture suggests potential biological activity, possibly as a pharmaceutical agent or in other applications, due to the presence of hydroxyl groups that can participate in various chemical reactions. Its solubility profile would likely be influenced by the balance of hydrophobic and hydrophilic regions within the molecule. As with many organic compounds, its stability, reactivity, and potential applications would depend on environmental conditions and the presence of other chemical species. Further studies would be necessary to elucidate its specific properties and potential uses in various fields.

Formula: C₂₃H₃₄O₆

InChI: InChI=1/C23H34O6/c1-4-13(2)23(27)29-20-7-5-6-15-10-19(25)14(3)18(22(15)20)9-8-17-11-16(24)12-21(26)28-17/h5-6,10,13-14,16-20,22,24-25H,4,7-9,11-12H2,1-3H3

SMILES: CCC(C)C(=O)OC1CC=CC2=CC(C(C)C(CCC3CC(CC(=O)O3)O)C12)O

Synonyms:

• Butanoic acid, 2-methyl-, 1,2,6,7,8,8a-hexahydro-6-hydroxy-7-methyl-8-(2-(tetrahydro-4-hydroxy-6-oxo-2H-pyran-2-yl)ethyl)-1-naphthalenyl ester

3α-Hydroxy Pravastatin Lactone

Controlled Product

CAS: 85798-96-5

Formula: C₂₃H₃₄O₆

Color and Shape: Neat

Molecular weight: 406.51

Ref: TR-H952300

3α-Hydroxy Pravastatin Lactone

CAS: 85798-96-5

Formula: C₂₃H₃₄O₆

Molecular weight: 406.52

Ref: ST-EA-CP-P52014