CAS 858001-69-1
:1-(2-aminoethyl)urea hydrochloride
Description:
1-(2-Aminoethyl)urea hydrochloride, with the CAS number 858001-69-1, is a chemical compound characterized by its urea functional group and an aminoethyl side chain. It is typically encountered as a white to off-white crystalline solid, which is soluble in water due to the presence of the hydrochloride salt form. This solubility enhances its utility in various biological and chemical applications. The compound exhibits basic properties due to the amino group, allowing it to participate in various chemical reactions, including those involving nucleophilic substitutions. It may also serve as a building block in the synthesis of pharmaceuticals or agrochemicals. Additionally, its structural features suggest potential interactions with biological systems, making it of interest in medicinal chemistry. Safety data should be consulted to understand its handling and toxicity, as with any chemical substance. Overall, 1-(2-aminoethyl)urea hydrochloride is a versatile compound with applications in research and industry, particularly in fields related to biochemistry and drug development.
Formula:C3H10ClN3O
InChI:InChI=1/C3H9N3O.ClH/c4-1-2-6-3(5)7;/h1-2,4H2,(H3,5,6,7);1H
SMILES:C(CNC(=N)O)N.Cl
Synonyms:- 1-(2-Aminoethyl)urea hydrochloride (1:1)
- Urea, N-(2-aminoethyl)-, hydrochloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(2-AMINO-ETHYL)-UREA HCL
CAS:Formula:C3H10ClN3OPurity:95%Color and Shape:SolidMolecular weight:139.5840(2-Aminoethyl)urea hydrochloride
CAS:<p>(2-Aminoethyl)urea hydrochloride</p>Molecular weight:139.584g/mol(2-Amino-ethyl)-urea hydrochloride
CAS:Formula:C3H10ClN3OPurity:95%Color and Shape:Solid, CrystallineMolecular weight:139.58(2-Amino-ethyl)-urea hydrochloride
CAS:<p>(2-Amino-ethyl)-urea hydrochloride is a ligand that binds to the nitro group of the aromatic amine, phenylhydrazine. This binding prevents the formation of reactive oxygen species, which are involved in neurodegeneration and cancer. The affinity for the ligand is determined by steric factors, with methyl ester being more potent than ethyl ester. The 2-aminoethyl urea ligand binds to the carboxylate region of phenylhydrazine and inhibits its activity.</p>Formula:C3H10ClN3OPurity:Min. 95%Molecular weight:139.58 g/mol





