CAS 858004-29-2

3,5-Dichloro-2-methylbenzenesulfonyl chloride

Description:

3,5-Dichloro-2-methylbenzenesulfonyl chloride is an organic compound characterized by its sulfonyl chloride functional group, which is known for its reactivity and utility in organic synthesis. This compound features a benzene ring substituted with two chlorine atoms at the 3 and 5 positions and a methyl group at the 2 position, contributing to its unique chemical properties. The presence of the sulfonyl chloride group makes it a potent electrophile, allowing it to participate in various nucleophilic substitution reactions. It is typically used as a reagent in the synthesis of sulfonamides and other sulfonyl-containing compounds. The compound is likely to be a solid at room temperature and may exhibit moderate to high toxicity, necessitating careful handling and storage. Additionally, it may be sensitive to moisture, as sulfonyl chlorides can hydrolyze to form sulfonic acids. Proper safety precautions, including the use of personal protective equipment, are essential when working with this chemical.

Formula: C₇H₅Cl₃O₂S

InChI: InChI=1S/C7H5Cl3O2S/c1-4-6(9)2-5(8)3-7(4)13(10,11)12/h2-3H,1H3

InChI key: InChIKey=CMRRUAYJIAXQRY-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C1=C(C)C(Cl)=CC(Cl)=C1

Synonyms:

• 3,5-Dichloro-2-methylbenzenesulfonyl chloride
• 3,5-Dichloro-2-methylbenzene-1-sulfonyl chloride
• Benzenesulfonyl chloride, 3,5-dichloro-2-methyl-
• o-Toluenesulfonyl chloride, 3,5-dichloro-