CAS 858024-79-0

Naphthalene, 2-chloro-6-iodo-

Description:

Naphthalene, 2-chloro-6-iodo- is a halogenated aromatic compound characterized by the presence of both chlorine and iodine substituents on a naphthalene ring. This compound features a two-ring structure typical of naphthalene, with the chlorine atom located at the 2-position and the iodine atom at the 6-position. The presence of these halogens significantly influences its chemical reactivity and physical properties. Generally, halogenated naphthalenes exhibit increased stability and can participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The compound may also display unique solubility characteristics, often being soluble in organic solvents while having limited solubility in water. Additionally, due to the presence of halogens, it may exhibit distinct biological activities, making it of interest in fields such as medicinal chemistry and materials science. Safety considerations are important, as halogenated compounds can be toxic or hazardous, necessitating careful handling and disposal.

Formula: C₁₀H₆ClI

InChI: InChI=1S/C10H6ClI/c11-9-3-1-8-6-10(12)4-2-7(8)5-9/h1-6H

InChI key: InChIKey=LKWKYFPFZOBUIC-UHFFFAOYSA-N

SMILES: ClC1=CC2=C(C=C(I)C=C2)C=C1

Synonyms:

• 2-Chloro-6-iodonaphthalene
• Naphthalene, 2-chloro-6-iodo-