CymitQuimica logo

CAS 85803-29-8

:

N-(4-{[(2,4-diaminopteridin-6-yl)methyl]amino}-2-fluorobenzoyl)-L-glutamic acid

Description:
N-(4-{[(2,4-diaminopteridin-6-yl)methyl]amino}-2-fluorobenzoyl)-L-glutamic acid, with CAS number 85803-29-8, is a synthetic compound that belongs to the class of amino acids and derivatives. This substance features a complex structure that includes a glutamic acid backbone, which is an important amino acid involved in various metabolic processes. The presence of a fluorobenzoyl group and a pteridinyl moiety indicates potential biological activity, particularly in relation to enzyme inhibition or modulation, making it of interest in pharmaceutical research. The compound's design suggests it may interact with specific biological targets, possibly in cancer therapy or as an anti-metabolite. Its solubility, stability, and reactivity would depend on the specific functional groups present, and it may exhibit unique properties due to the fluorine atom, which can influence its pharmacokinetics and pharmacodynamics. Overall, this compound represents a significant area of study in medicinal chemistry, particularly in the development of targeted therapies.
Formula:C19H19FN8O5
InChI:InChI=1/C19H19FN8O5/c20-11-5-8(1-2-10(11)17(31)26-12(18(32)33)3-4-13(29)30)23-6-9-7-24-16-14(25-9)15(21)27-19(22)28-16/h1-2,5,7,12,23H,3-4,6H2,(H,26,31)(H,29,30)(H,32,33)(H4,21,22,24,27,28)/t12-/m0/s1
SMILES:c1cc(c(cc1NCc1cnc2c(c(N)[nH]c(=N)n2)n1)F)C(=N[C@@H](CCC(=O)O)C(=O)O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.