CAS 85811-56-9
:7-(chloromethyl)-3-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidin-5-one
Description:
7-(Chloromethyl)-3-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidin-5-one, with the CAS number 85811-56-9, is a heterocyclic compound characterized by its unique thiazolo and pyrimidinone structures. This compound features a chloromethyl group, which enhances its reactivity and potential for further chemical modifications. The presence of a phenyl group contributes to its aromatic characteristics, influencing its solubility and interaction with biological systems. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The thiazolo and pyrimidinone moieties are known for their roles in various pharmacological activities, including antimicrobial and anticancer properties. Additionally, the compound's stability and reactivity can be influenced by the presence of the chloromethyl group, which may participate in nucleophilic substitution reactions. Overall, this compound represents a class of organic molecules that are valuable in research and potential therapeutic applications.
Formula:C13H9ClN2OS
InChI:InChI=1/C13H9ClN2OS/c14-7-10-6-12(17)16-11(8-18-13(16)15-10)9-4-2-1-3-5-9/h1-6,8H,7H2
SMILES:c1ccc(cc1)c1csc2nc(cc(=O)n12)CCl
Synonyms:- 5H-thiazolo[3,2-a]pyrimidin-5-one, 7-(chloromethyl)-3-phenyl-
- 7-Chloromethyl-3-phenyl-thiazolo[3,2-a]pyrimidin-5-one
- 7-(Chloromethyl)-3-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidin-5-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.