CAS 85817-22-7

N-Methyl-2-piperazinecarboxamide

Description:

N-Methyl-2-piperazinecarboxamide, with the CAS number 85817-22-7, is a chemical compound characterized by its piperazine ring structure, which is a six-membered ring containing two nitrogen atoms. This compound features a methyl group attached to one of the nitrogen atoms and a carboxamide functional group, contributing to its polar nature and potential solubility in polar solvents. It is typically a colorless to pale yellow liquid or solid, depending on its form and purity. The presence of the carboxamide group suggests that it may exhibit hydrogen bonding capabilities, influencing its reactivity and interactions with other molecules. N-Methyl-2-piperazinecarboxamide may be utilized in various applications, including pharmaceuticals and agrochemicals, due to its potential biological activity. As with many piperazine derivatives, it may also exhibit properties such as basicity and the ability to act as a ligand in coordination chemistry. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.

Formula: C₆H₁₃N₃O

InChI: InChI=1S/C6H13N3O/c1-7-6(10)5-4-8-2-3-9-5/h5,8-9H,2-4H2,1H3,(H,7,10)

InChI key: InChIKey=VPMJTASZJZRIMH-UHFFFAOYSA-N

SMILES: C(NC)(=O)C1CNCCN1

Synonyms:

• 2-Piperazinecarboxamide, N-methyl-
• N-Methyl-2-piperazinecarboxamide
• Piperazine-2-carboxylic acid methylamide