CAS 85819-03-0
:piperidine-2,4-dicarboxylic acid
Description:
Piperidine-2,4-dicarboxylic acid is a bicyclic organic compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features two carboxylic acid functional groups located at the 2 and 4 positions of the piperidine ring, contributing to its acidity and reactivity. It is typically a white to off-white crystalline solid that is soluble in water and polar organic solvents due to the presence of the carboxylic acid groups. The compound is of interest in various fields, including medicinal chemistry and organic synthesis, as it can serve as a building block for more complex molecules. Its derivatives may exhibit biological activity, making it relevant in drug development. Additionally, the presence of the nitrogen atom in the piperidine ring can influence its basicity and interaction with biological systems. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C7H11NO4
InChI:InChI=1/C7H11NO4/c9-6(10)4-1-2-8-5(3-4)7(11)12/h4-5,8H,1-3H2,(H,9,10)(H,11,12)
SMILES:C1CNC(CC1C(=O)O)C(=O)O
Synonyms:- 2,4-Piperidinedicarboxylic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.