CAS 858206-60-7
:5-Methyl-5-(2-pyridinyl)-2,4-imidazolidinedione
Description:
5-Methyl-5-(2-pyridinyl)-2,4-imidazolidinedione, with the CAS number 858206-60-7, is a chemical compound characterized by its imidazolidinedione structure, which features a five-membered ring containing two nitrogen atoms and two carbonyl groups. This compound is notable for its pyridine substituent, which contributes to its potential biological activity and solubility properties. Typically, imidazolidinediones exhibit a range of pharmacological effects, including anti-inflammatory and antidiabetic activities, making them of interest in medicinal chemistry. The presence of the methyl and pyridine groups can influence the compound's reactivity, stability, and interaction with biological targets. Additionally, the compound's physical properties, such as melting point, solubility, and spectral characteristics, are essential for its application in research and development. Overall, 5-Methyl-5-(2-pyridinyl)-2,4-imidazolidinedione represents a class of compounds that may have significant implications in drug discovery and development.
Formula:C9H9N3O2
InChI:InChI=1S/C9H9N3O2/c1-9(6-4-2-3-5-10-6)7(13)11-8(14)12-9/h2-5H,1H3,(H2,11,12,13,14)
InChI key:InChIKey=XJMXCMLOKKXNBI-UHFFFAOYSA-N
SMILES:CC1(NC(=O)NC1=O)C2=CC=CC=N2
Synonyms:- 5-(Pyridin-2-yl)-5-methylimidazolidine-2,4-dione
- 5-Methyl-5-(pyridin-2-yl)imidazolidine-2,4-dione
- 2,4-Imidazolidinedione, 5-methyl-5-(2-pyridinyl)-
- Hydantoin, 5-methyl-5-(2-pyridyl)-
- 5-Methyl-5-(2-pyridinyl)-2,4-imidazolidinedione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
