CAS 85822-16-8
:4-formylbenzenesulfonyl chloride
Description:
4-Formylbenzenesulfonyl chloride, with the CAS number 85822-16-8, is an organic compound characterized by the presence of both a formyl group (-CHO) and a sulfonyl chloride group (-SO2Cl) attached to a benzene ring. This compound typically appears as a white to light yellow solid and is known for its reactivity, particularly due to the sulfonyl chloride functional group, which can undergo nucleophilic substitution reactions. It is soluble in organic solvents such as dichloromethane and chloroform but is generally insoluble in water. The compound is often used as an intermediate in organic synthesis, particularly in the preparation of sulfonamides and other sulfonyl-containing compounds. Due to its reactive nature, it should be handled with care, as it can be corrosive and may cause irritation to the skin, eyes, and respiratory system. Proper safety precautions, including the use of personal protective equipment, are essential when working with this substance in a laboratory setting.
Formula:C7H5ClO3S
InChI:InChI=1/C7H5ClO3S/c8-12(10,11)7-3-1-6(5-9)2-4-7/h1-5H
SMILES:c1cc(ccc1C=O)S(=O)(=O)Cl
Synonyms:- Benzenesulfonyl chloride, 4-formyl-
- 4-Formyl-benzenesulfonyl chloride
- 4-Formylbenzenesulfonyl chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Formylbenzene-1-sulfonyl chloride
CAS:Formula:C7H5ClO3SPurity:98%Color and Shape:SolidMolecular weight:204.63084-Formylbenzenesulfonyl chloride
CAS:<p>4-Formylbenzenesulfonyl chloride</p>Formula:C7H5ClO3SPurity:95%Color and Shape: faint yellow solidMolecular weight:204.63g/mol4-Formylbenzenesulfonyl chloride
CAS:Formula:C7H5ClO3SPurity:96%Color and Shape:SolidMolecular weight:204.624-formylbenzene-1-sulfonyl chloride
CAS:<p>4-Formylbenzene-1-sulfonyl chloride is an alkylating agent that can be used to produce amines. It is the most efficient reagent for the reductive amination of carbonyl groups, and it also reacts with nucleophiles in a nucleophilic substitution reaction. The reaction of 4-formylbenzene-1-sulfonyl chloride with potassium carbonate produces formaldehyde and potassium sulfite. This product is soluble in water and organic solvents, which makes it useful for reactions involving high boiling points. Yields are typically 50%.</p>Formula:C7H5ClO3SPurity:Min. 95%Molecular weight:204.6 g/mol



