CAS 85825-85-0

2-[(4-methylbenzyl)oxy]benzaldehyde

Description:

2-[(4-Methylbenzyl)oxy]benzaldehyde, with the CAS number 85825-85-0, is an organic compound characterized by its aromatic structure. It features a benzaldehyde functional group, which is a key characteristic of aldehydes, and an ether linkage due to the presence of a methoxy group attached to a para-methylbenzyl moiety. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic aromatic components. The compound may exhibit a pleasant aromatic odor, making it potentially useful in fragrance applications. Additionally, it may participate in various chemical reactions typical of aldehydes, such as oxidation and condensation reactions. Safety data should be consulted for handling, as with many organic compounds, it may pose health risks if ingested or inhaled. Overall, 2-[(4-methylbenzyl)oxy]benzaldehyde is of interest in both synthetic organic chemistry and industrial applications.

Formula: C₁₅H₁₄O₂

InChI: InChI=1/C15H14O2/c1-12-6-8-13(9-7-12)11-17-15-5-3-2-4-14(15)10-16/h2-10H,11H2,1H3

SMILES: Cc1ccc(cc1)COc1ccccc1C=O

Synonyms:

• Benzaldehyde, 2-[(4-Methylphenyl)Methoxy]-

2-[(4-methylbenzyl)oxy]benzaldehyde

CAS: 85825-85-0

Formula: C₁₅H₁₄O₂

Purity: 95%

Molecular weight: 226.275

Ref: 10-F307551