CAS 858262-19-8
:3-(2-Pyrrolidinyl)piperidine
Description:
3-(2-Pyrrolidinyl)piperidine, with the CAS number 858262-19-8, is a chemical compound characterized by its bicyclic structure, which consists of a piperidine ring and a pyrrolidine substituent. This compound is typically classified as a tertiary amine due to the presence of nitrogen atoms in its rings. It exhibits properties such as being a colorless to pale yellow liquid or solid, depending on its form and purity. The compound is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may interact with various biological targets, including neurotransmitter receptors. Its molecular structure allows for flexibility and potential for various chemical modifications, which can influence its biological activity. Additionally, 3-(2-Pyrrolidinyl)piperidine may exhibit solubility in organic solvents, making it suitable for various synthetic processes. Safety and handling precautions should be observed, as with many nitrogen-containing compounds, due to potential toxicity and reactivity.
Formula:C9H18N2
InChI:InChI=1/C9H18N2/c1-3-8(7-10-5-1)9-4-2-6-11-9/h8-11H,1-7H2
SMILES:C1CC(CNC1)C1CCCN1
Synonyms:- 3-(2-Pyrrolidinyl)piperidin
- 3-(Pyrrolidin-2-yl)piperidine
- Piperidine, 3-(2-Pyrrolidinyl)-
- 3-(2-Pyrrolidinyl)piperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
