CAS 85828-82-6
:Ethyl 3,5-diiodo-4-(4-methoxyphenoxy)benzeneacetate
Description:
Ethyl 3,5-diiodo-4-(4-methoxyphenoxy)benzeneacetate is a chemical compound characterized by its complex structure, which includes an ethyl ester functional group, two iodine atoms, and a methoxyphenoxy substituent. This compound is typically classified as an organic halide due to the presence of iodine, which can influence its reactivity and biological activity. The methoxy group contributes to its solubility and potential interactions in various chemical environments. The presence of multiple halogen atoms often enhances the compound's stability and can affect its pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound may exhibit unique optical and electronic properties due to its aromatic system. Its synthesis and applications may be relevant in fields such as drug development, agrochemicals, or materials science, where halogenated compounds are often explored for their diverse functionalities. As with many organic compounds, safety and handling precautions are essential due to potential toxicity associated with halogenated substances.
Formula:C17H16I2O4
InChI:InChI=1S/C17H16I2O4/c1-3-22-16(20)10-11-8-14(18)17(15(19)9-11)23-13-6-4-12(21-2)5-7-13/h4-9H,3,10H2,1-2H3
InChI key:InChIKey=BCLWYRUGYYCELP-UHFFFAOYSA-N
SMILES:O(C1=C(I)C=C(CC(OCC)=O)C=C1I)C2=CC=C(OC)C=C2
Synonyms:- Ethyl 3,5-diiodo-4-(4-methoxyphenoxy)benzeneacetate
- Ethyl 3,5-diiodo-4-(4-methoxyphenoxy)phenylacetate
- Acetic acid, [3,5-diiodo-4-(p-methoxyphenoxy)phenyl]-, ethyl ester
- Benzeneacetic acid, 3,5-diiodo-4-(4-methoxyphenoxy)-, ethyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3,5-Diiodo-4’-o-methyl thyroacetic acid ethyl ester
CAS:Please enquire for more information about 3,5-Diiodo-4’-o-methyl thyroacetic acid ethyl ester including the price, delivery time and more detailed product information at the technical inquiry form on this page
Formula:C17H16I2O4Purity:Min. 95%Molecular weight:538.11 g/mol3,5-Diiodo-4’-O-methyl Thyroacetic Acid Ethyl Ester
CAS:Applications 3,5-Diiodo-4’-O-methyl Thyroacetic Acid Ethyl Ester is a derivative of 3,5-Diiodo Thyroacetic Acid (D455140), the acetic acid analog of Thyroxine (T425601). It is a reactant in the preparation of bifunctional thyrointegrin inhibitors, thyroxine (T425601) and triiodothyronine (T795380).
References Bridoux, A. et al.: J. Enz. Inh. Med. Chem., 26, 871 (2011); Wilkinson, J.: Biochem. J., 63, 601 (1956); Wilkinson, J.: Chem. Ind., 1352 (1955)Formula:C17H16I2O4Color and Shape:White SolidMolecular weight:538.12

