CAS 85841-04-9
:6-(4-Chlorophenyl)-2-methylpyrazolo[1,5-a]pyrimidin-7-amine
Description:
6-(4-Chlorophenyl)-2-methylpyrazolo[1,5-a]pyrimidin-7-amine, with the CAS number 85841-04-9, is a chemical compound that belongs to the class of pyrazolopyrimidines. This substance is characterized by its pyrazolo and pyrimidine ring structures, which contribute to its potential biological activity. The presence of a 4-chlorophenyl group enhances its lipophilicity and may influence its interaction with biological targets. The compound typically exhibits properties such as moderate solubility in organic solvents and may have specific reactivity patterns due to the functional groups present. It is often studied for its pharmacological properties, particularly in the context of medicinal chemistry, where it may serve as a lead compound for the development of therapeutic agents. The compound's structure suggests potential applications in areas such as oncology or neurology, although specific biological activities would require empirical investigation. As with many chemical substances, safety data and handling precautions should be considered when working with this compound in a laboratory setting.
Formula:C13H11ClN4
InChI:InChI=1S/C13H11ClN4/c1-8-6-12-16-7-11(13(15)18(12)17-8)9-2-4-10(14)5-3-9/h2-7H,15H2,1H3
InChI key:InChIKey=VKFQPRHPASNMKO-UHFFFAOYSA-N
SMILES:NC=1N2C(N=CC1C3=CC=C(Cl)C=C3)=CC(C)=N2
Synonyms:- 6-(4-Chlorophenyl)-2-methylpyrazolo[1,5-a]pyrimidin-7-amine
- Pyrazolo[1,5-a]pyrimidin-7-amine, 6-(4-chlorophenyl)-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-(4-Chlorophenyl)-2-methylpyrazolo[1,5-a]pyrimidin-7-amine
CAS:<p>6-(4-Chlorophenyl)-2-methylpyrazolo[1,5-a]pyrimidin-7-amine</p>Purity:techMolecular weight:258.71g/mol
