CAS 858416-08-7
:5-(chloromethyl)-1-cyclohexyl-imidazole
Description:
5-(Chloromethyl)-1-cyclohexyl-imidazole is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a chloromethyl group (-CH2Cl) at the 5-position of the imidazole ring introduces reactivity, making it a potential intermediate in organic synthesis. The cyclohexyl group attached to the 1-position contributes to the compound's hydrophobic characteristics, influencing its solubility and interaction with biological systems. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in various fields, including pharmaceuticals and agrochemicals. As with many organic compounds, the specific properties such as melting point, boiling point, and solubility would depend on the conditions and purity of the substance. Safety data should be consulted to understand its handling and potential hazards, as the presence of chlorine can indicate toxicity or reactivity under certain conditions.
Formula:C10H15ClN2
InChI:InChI=1/C10H15ClN2/c11-6-10-7-12-8-13(10)9-4-2-1-3-5-9/h7-9H,1-6H2
SMILES:C1CCC(CC1)n1cncc1CCl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.