CAS 858431-29-5
:3-(chloromethyl)pyridin-2-amine
Description:
3-(Chloromethyl)pyridin-2-amine is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a chloromethyl group (-CH2Cl) and an amino group (-NH2) attached to the pyridine ring, specifically at the 2-position and 3-position, respectively. The presence of the chloromethyl group makes it a reactive intermediate, often utilized in organic synthesis for further functionalization. The amino group contributes to its basicity and potential for forming hydrogen bonds, which can influence its solubility and reactivity in various chemical environments. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for various applications, including in the synthesis of pharmaceuticals and agrochemicals. Safety precautions should be observed when handling this compound due to the presence of the chloromethyl group, which can be hazardous.
Formula:C6H7ClN2
InChI:InChI=1/C6H7ClN2/c7-4-5-2-1-3-9-6(5)8/h1-3H,4H2,(H2,8,9)
SMILES:c1cc(CCl)c(N)nc1
Synonyms:- 2-Amino-3-chloromethyl pyridine
- 2-Pyridinamine, 3-(Chloromethyl)-
- 3-(Chloromethyl)pyridin-2-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
