CAS 858435-00-4

1-Naphthalenemethanamine, α-propyl-, hydrochloride (1:1)

Description:

1-Naphthalenemethanamine, α-propyl-, hydrochloride (1:1), with the CAS number 858435-00-4, is a chemical compound characterized by its naphthalene structure, which is a polycyclic aromatic hydrocarbon. This compound features an amine functional group, specifically a propyl group attached to the naphthalene ring, contributing to its basicity and potential reactivity. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and other polar solvents. The presence of the hydrochloride indicates that the amine is protonated, which can influence its biological activity and interaction with other substances. This compound may exhibit properties such as being a potential intermediate in organic synthesis or having applications in pharmaceuticals, though specific uses would depend on further research and context. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure proper safety measures are taken.

Formula: C₁₄H₁₇N·ClH

InChI: InChI=1S/C14H17N.ClH/c1-2-6-14(15)13-10-5-8-11-7-3-4-9-12(11)13;/h3-5,7-10,14H,2,6,15H2,1H3;1H

InChI key: InChIKey=XFVOILFLSYBTTL-UHFFFAOYSA-N

SMILES: C(CCC)(N)C=1C2=C(C=CC1)C=CC=C2.Cl

Synonyms:

• 1-(Naphthalen-1-yl)butan-1-amine hydrochloride
• 1-Naphthalenemethylamine, α-propyl-, -HCl
• 1-Naphthalenemethanamine, α-propyl-, hydrochloride (1:1)