CAS 85845-02-9

N-{[3-(trifluoromethyl)phenyl]sulfonyl}glycine

Description:

N-{[3-(trifluoromethyl)phenyl]sulfonyl}glycine, with the CAS number 85845-02-9, is an organic compound characterized by its sulfonamide functional group and the presence of a trifluoromethyl group attached to a phenyl ring. This compound typically exhibits properties associated with sulfonamides, such as good solubility in polar solvents and potential biological activity. The trifluoromethyl group enhances lipophilicity and can influence the compound's reactivity and interaction with biological targets. The sulfonyl group contributes to the compound's acidity and can participate in hydrogen bonding, affecting its overall stability and reactivity. N-{[3-(trifluoromethyl)phenyl]sulfonyl}glycine may be of interest in medicinal chemistry due to its potential pharmacological properties, including antibacterial or anti-inflammatory activities. Its structural features suggest it could serve as a building block for more complex molecules in drug development. As with many sulfonamides, safety and handling precautions should be observed due to potential toxicity and environmental impact.

Formula: C₉H₈F₃NO₄S

InChI: InChI=1/C9H8F3NO4S/c10-9(11,12)6-2-1-3-7(4-6)18(16,17)13-5-8(14)15/h1-4,13H,5H2,(H,14,15)

SMILES: c1cc(cc(c1)S(=O)(=O)NCC(=O)O)C(F)(F)F

Synonyms:

• ({[3-(Trifluoromethyl)Phenyl]Sulfonyl}Amino)Acetic Acid
• glycine, N-[[3-(trifluoromethyl)phenyl]sulfonyl]-

(([3-(Trifluoromethyl)phenyl]sulfonyl)amino)acetic acid

CAS: 85845-02-9

Formula: C₉H₈F₃NO₄S

Molecular weight: 283.2243

Ref: IN-DA008GF7