CAS 858513-51-6

N,1-dimethyl-4-nitro-1H-imidazole-5-carboxamide

Description:

N,1-dimethyl-4-nitro-1H-imidazole-5-carboxamide is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a dimethyl group at the nitrogen position and a nitro group at the 4-position of the imidazole ring, contributing to its unique chemical properties. The carboxamide functional group at the 5-position enhances its solubility in polar solvents and may influence its biological activity. The presence of the nitro group typically imparts electron-withdrawing characteristics, which can affect the compound's reactivity and interactions with biological targets. This compound may be of interest in pharmaceutical research due to its potential biological activities, including antimicrobial or anticancer properties, although specific biological data would depend on empirical studies. As with many nitro-containing compounds, it is essential to handle this substance with care due to potential toxicity and environmental considerations.

Formula: C₆H₈N₄O₃

InChI: InChI=1/C6H8N4O3/c1-7-6(11)4-5(10(12)13)8-3-9(4)2/h3H,1-2H3,(H,7,11)

SMILES: CN=C(c1c(ncn1C)N(=O)=O)O

N,1-Dimethyl-4-nitro-5-imidazolecarboxamide

Controlled Product

CAS: 858513-51-6

Applications N,1-Dimethyl-4-nitro-5-imidazolecarboxamide (cas# 858513-51-6) is a compound useful in organic synthesis.

Formula: C₆H₈N₄O₃

Color and Shape: Neat

Molecular weight: 184.15

Ref: TR-D474900