CymitQuimica logo

CAS 858515-66-9

:

7-Fluoro-1H-indole-3-carboxylic acid

Description:
7-Fluoro-1H-indole-3-carboxylic acid is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a fluorine atom at the 7-position of the indole ring contributes to its unique reactivity and potential biological activity. The carboxylic acid functional group at the 3-position enhances its solubility in polar solvents and allows for potential interactions in biochemical pathways. This compound is often studied for its role in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with various biological targets. Its molecular structure allows for various modifications, making it a versatile scaffold in drug design. Additionally, the fluorine substitution can influence the compound's lipophilicity and metabolic stability, which are critical factors in pharmacokinetics. Overall, 7-Fluoro-1H-indole-3-carboxylic acid is of interest in both synthetic and medicinal chemistry for its potential applications in drug discovery and development.
Formula:C9H6FNO2
InChI:InChI=1S/C9H6FNO2/c10-7-3-1-2-5-6(9(12)13)4-11-8(5)7/h1-4,11H,(H,12,13)
InChI key:BGNHSQYGVIUBBX-UHFFFAOYSA-N
SMILES:C1=CC2=C(C(=C1)F)NC=C2C(=O)O
Synonyms:
  • 1H-Indole-3-carboxylic acid, 7-fluoro-
  • 7-Fluoro-indole-3-carboxylic acid
  • 7-Fluoroindole-3-Carboxylic Acid
  • See more synonyms
Found 4 products.