CAS 858516-70-8

6-Bromo-2-(4-methylphenyl)imidazo[1,2-a]pyridine

Description:

6-Bromo-2-(4-methylphenyl)imidazo[1,2-a]pyridine is a heterocyclic organic compound characterized by its imidazo[1,2-a]pyridine core, which features a fused ring system containing both nitrogen and carbon atoms. The presence of a bromine atom at the 6-position and a para-methylphenyl group at the 2-position contributes to its unique chemical properties and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the imidazole and pyridine functionalities, which are known to interact with biological targets. Additionally, the bromine substituent can enhance reactivity and facilitate further chemical modifications. Overall, 6-Bromo-2-(4-methylphenyl)imidazo[1,2-a]pyridine is of interest in research for its potential roles in drug discovery and development.

Formula: C₁₄H₁₁BrN₂

InChI: InChI=1/C14H11BrN2/c1-10-2-4-11(5-3-10)13-9-17-8-12(15)6-7-14(17)16-13/h2-9H,1H3

SMILES: Cc1ccc(cc1)c1cn2cc(ccc2n1)Br

Synonyms:

• Imidazo[1,2-A]Pyridine, 6-Bromo-2-(4-Methylphenyl)-
• 6-Bromo-2-(4-methylphenyl)imidazo[1,2-a]pyridine

6-bromo-2-(p-tolyl)imidazo[1,2-a]pyridine

CAS: 858516-70-8

Formula: C₁₄H₁₁BrN₂

Molecular weight: 287.1545

Ref: IN-DA00G5EA