
CAS 85866-09-7
:13-Tetradecene-1,2-diol
Description:
13-Tetradecene-1,2-diol is a long-chain aliphatic diol characterized by the presence of a double bond and two hydroxyl (-OH) functional groups. This compound features a 14-carbon backbone with the double bond located between the first and second carbon atoms, contributing to its unsaturated nature. The presence of hydroxyl groups makes it a diol, which enhances its solubility in water compared to typical hydrocarbons. 13-Tetradecene-1,2-diol is typically a colorless to pale yellow liquid at room temperature and exhibits properties such as moderate viscosity and surface activity. It is often utilized in various applications, including as an intermediate in the synthesis of surfactants, emulsifiers, and other chemical products. Additionally, due to its structural characteristics, it may exhibit biological activity and can be studied for potential applications in pharmaceuticals or as a biochemical reagent. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C14H28O2
InChI:InChI=1S/C14H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-14(16)13-15/h2,14-16H,1,3-13H2
InChI key:InChIKey=KLRIGFIZXKJATE-UHFFFAOYSA-N
SMILES:C(CCC(CO)O)CCCCCCCC=C
Synonyms:- 13-Tetradecene-1,2-diol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.