CymitQuimica logo

CAS 858671-75-7

:

6-Cyclopropyl-1,2-benzisothiazole-3-carboxylic acid

Description:
6-Cyclopropyl-1,2-benzisothiazole-3-carboxylic acid is a chemical compound characterized by its unique bicyclic structure, which includes a benzene ring fused to a thiazole ring, along with a cyclopropyl substituent and a carboxylic acid functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carboxylic acid group. The cyclopropyl group can influence the compound's steric and electronic properties, potentially affecting its biological activity and solubility. It may be of interest in medicinal chemistry for its potential pharmacological applications, particularly in the development of novel therapeutic agents. The presence of the thiazole moiety often suggests potential interactions with biological targets, making it a candidate for further research in drug discovery. As with many organic compounds, its behavior in various solvents and under different conditions can provide insights into its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C11H9NO2S
InChI:InChI=1S/C11H9NO2S/c13-11(14)10-8-4-3-7(6-1-2-6)5-9(8)15-12-10/h3-6H,1-2H2,(H,13,14)
InChI key:InChIKey=MXTHJMVXICGTKL-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=2C(=CC(=CC2)C3CC3)SN1
Synonyms:
  • 1,2-Benzisothiazole-3-carboxylic acid, 6-cyclopropyl-
  • 6-Cyclopropyl-1,2-benzisothiazole-3-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.