CymitQuimica logo

CAS 85868-36-6

:

3-nitro-4-piperidin-1-ylpyridine

Description:
3-Nitro-4-piperidin-1-ylpyridine is a chemical compound characterized by its pyridine ring structure, which is substituted at the 3-position with a nitro group and at the 4-position with a piperidinyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to the presence of the pyridine and piperidine moieties. The nitro group contributes to its potential reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions and reductions. The piperidine ring enhances its solubility in polar solvents and may influence its biological activity, as piperidine derivatives are often found in pharmaceuticals. The compound's molecular structure suggests it may exhibit basic properties, and it could participate in hydrogen bonding due to the presence of nitrogen atoms. Overall, 3-nitro-4-piperidin-1-ylpyridine is of interest in medicinal chemistry and material science, where its unique structural features can be leveraged for the development of new compounds.
Formula:C10H13N3O2
InChI:InChI=1/C10H13N3O2/c14-13(15)10-8-11-5-4-9(10)12-6-2-1-3-7-12/h4-5,8H,1-3,6-7H2
SMILES:C1CCN(CC1)c1ccncc1N(=O)=O
Synonyms:
  • 3-Nitro-4-(piperidin-1-yl)pyridine
  • Pyridine, 3-Nitro-4-(1-Piperidinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.