CAS 85870-49-1
:1,2-Dihydro-6-nitro-2-oxo-3-quinolinecarboxylic acid
Description:
1,2-Dihydro-6-nitro-2-oxo-3-quinolinecarboxylic acid, with the CAS number 85870-49-1, is a chemical compound that belongs to the class of quinoline derivatives. This substance features a quinoline ring structure, which is characterized by a bicyclic aromatic system composed of a benzene ring fused to a pyridine ring. The presence of a nitro group at the 6-position and a carboxylic acid functional group at the 3-position contributes to its chemical reactivity and potential biological activity. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as quinoline derivatives are known for their diverse biological activities, including antimicrobial and anti-inflammatory properties. However, specific properties such as melting point, boiling point, and spectral data would require further investigation or reference to specialized databases for precise information.
Formula:C10H6N2O5
InChI:InChI=1S/C10H6N2O5/c13-9-7(10(14)15)4-5-3-6(12(16)17)1-2-8(5)11-9/h1-4H,(H,11,13)(H,14,15)
InChI key:InChIKey=MBKQRJOWRRDAJL-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC=2C(NC1=O)=CC=C(N(=O)=O)C2
Synonyms:- 3-Quinolinecarboxylic acid, 1,2-dihydro-6-nitro-2-oxo-
- 2-Hydroxy-6-nitroquinoline-3-carboxylic acid
- 1,2-Dihydro-6-nitro-2-oxo-3-quinolinecarboxylic acid
- 2-Hydroxy-6-nitro-quinoline-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
