
CAS 85870-50-4
:6-Amino-1,2-dihydro-2-oxo-3-quinolinecarboxylic acid
Description:
6-Amino-1,2-dihydro-2-oxo-3-quinolinecarboxylic acid, with the CAS number 85870-50-4, is a chemical compound that belongs to the class of quinoline derivatives. This substance features a quinoline ring system, which is characterized by a bicyclic structure composed of a benzene ring fused to a pyridine ring. The presence of an amino group and a carboxylic acid functional group contributes to its potential as a biologically active molecule. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the functional groups present. The compound is of interest in medicinal chemistry, particularly for its potential pharmacological properties, which may include antibacterial or anticancer activities. Its structure allows for various chemical modifications, which can enhance its biological activity or alter its physicochemical properties. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of this compound may vary.
Formula:C10H8N2O3
InChI:InChI=1S/C10H8N2O3/c11-6-1-2-8-5(3-6)4-7(10(14)15)9(13)12-8/h1-4H,11H2,(H,12,13)(H,14,15)
InChI key:InChIKey=DIOKGSRWVHKXED-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC=2C(NC1=O)=CC=C(N)C2
Synonyms:- 3-Quinolinecarboxylic acid, 6-amino-1,2-dihydro-2-oxo-
- 6-Amino-1,2-dihydro-2-oxo-3-quinolinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.