CAS 858712-33-1
:4-morpholino-2-phenyl-butanoic acid
Description:
4-Morpholino-2-phenyl-butanoic acid, identified by its CAS number 858712-33-1, is a chemical compound characterized by its unique structure, which includes a morpholine ring and a phenyl group attached to a butanoic acid backbone. This compound typically exhibits properties such as being a white to off-white solid at room temperature, with moderate solubility in polar solvents like water and organic solvents. It is often studied for its potential biological activities, particularly in pharmacology, where it may act as a modulator or inhibitor in various biochemical pathways. The presence of the morpholine moiety suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's acid functional group can participate in hydrogen bonding, influencing its reactivity and interactions in biological systems. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with exposure.
Formula:C14H19NO3
InChI:InChI=1/C14H19NO3/c16-14(17)13(12-4-2-1-3-5-12)6-7-15-8-10-18-11-9-15/h1-5,13H,6-11H2,(H,16,17)
SMILES:c1ccc(cc1)C(CCN1CCOCC1)C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
