CAS 85872-53-3
:3,9-Dihydro-8-phenyl-1,3-dipropyl-1H-purine-2,6-dione
Description:
3,9-Dihydro-8-phenyl-1,3-dipropyl-1H-purine-2,6-dione, with CAS number 85872-53-3, is a purine derivative characterized by its complex structure that includes a purine ring system substituted with phenyl and propyl groups. This compound typically exhibits properties associated with purines, such as potential biological activity, including effects on adenosine receptors. Its molecular structure suggests it may possess lipophilic characteristics due to the presence of the phenyl and propyl groups, which can influence its solubility and permeability in biological systems. The compound may also exhibit pharmacological properties, making it of interest in medicinal chemistry and drug development. Additionally, its stability and reactivity can be influenced by the functional groups present, which may affect its interactions in various chemical environments. Overall, 3,9-Dihydro-8-phenyl-1,3-dipropyl-1H-purine-2,6-dione represents a class of compounds that could have significant implications in therapeutic applications.
Formula:C17H20N4O2
InChI:InChI=1/C17H20N4O2/c1-3-10-20-15-13(16(22)21(11-4-2)17(20)23)18-14(19-15)12-8-6-5-7-9-12/h5-9H,3-4,10-11H2,1-2H3,(H,18,19)
InChI key:InChIKey=CLIGSMOZKDCDRZ-UHFFFAOYSA-N
SMILES:C(CC)N1C2=C(NC(=N2)C3=CC=CC=C3)C(=O)N(CCC)C1=O
Synonyms:- 1,3-Dipropyl-8-phenylxanthine
- 1H-Purine-2,6-dione, 3,9-dihydro-8-phenyl-1,3-dipropyl-
- 1H-purine-2,6-dione, 3,7-dihydro-8-phenyl-1,3-dipropyl-
- 3,9-Dihydro-8-phenyl-1,3-dipropyl-1H-purine-2,6-dione
- 8-Phenyl-1,3-dipropyl-3,9-dihydro-1H-purine-2,6-dione
- Npc 200
- 8-Phenyl-1,3-dipropyl-3,7-dihydro-1H-purine-2,6-dione
- 8-Phenyl-1,3-dipropyl-1H-purine-2,6(3H,7H)-dione
- 3,7-dihydro-1,3-dipropyl-8-phenyl-1h-purine-2,6,dione
- 1,3-Dipropyl-8-phenyl-7H-purine-2,6(1H,3H)-dione
- 1,3 Dipropyl 8 phenylxanthine,1,3Dipropyl8phenylxanthine
- dione,3,7-dihydro-1,3-dipropyl-8-phenyl-1h-purine-6
- 3-Dipropyl-8-phenylxanthine
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Adenosine receptor A1 antagonist 5
CAS:Adenosine receptor A1 antagonist 5Purity:≥98%Molecular weight:312.37g/mol1,3-Dipropyl-8-phenylxanthine
CAS:Controlled ProductFormula:C17H20N4O2Color and Shape:NeatMolecular weight:312.3661,3-Dipropyl-8-phenylxanthine
CAS:Controlled Product1,3-Dipropyl-8-phenylxanthine is a receptor antagonist that blocks the activity of adenosine receptors. It binds to a-adrenergic receptors on the surface of cells and prevents the binding of adenosine. This drug is used in diagnosis and treatment of many diseases such as low potency, autoimmune diseases, encephalitis, and symptoms. 1,3-Dipropyl-8-phenylxanthine has been shown to be effective against symptoms associated with α subunit antibodies (e.g., myasthenia gravis).Formula:C17H20N4O2Purity:Min. 95%Molecular weight:312.37 g/molAdenosine receptor A1 antagonist 5
CAS:1,3-Dipropyl-8-phenylxanthine is an adenosine antagonist, oxypurine, insecticide, and reduces high blood pressure.Formula:C17H20N4O2Purity:99.97%Color and Shape:SolidMolecular weight:312.37



