CAS 85888-81-9

2-(chloromethyl)benzoic acid

Description:

2-(Chloromethyl)benzoic acid, with the CAS number 85888-81-9, is an aromatic carboxylic acid characterized by the presence of a chloromethyl group attached to the benzene ring. This compound typically appears as a white to off-white solid and is soluble in organic solvents, while exhibiting limited solubility in water due to its hydrophobic aromatic structure. The chloromethyl group introduces a reactive site, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The carboxylic acid functional group contributes to its acidic properties, allowing it to participate in acid-base reactions. Additionally, this compound may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its reactivity and functional groups enable it to serve as an intermediate in the synthesis of more complex organic molecules. Safety precautions should be taken when handling this substance, as it may pose health risks due to its chlorinated nature and potential irritant properties.

Formula: C₈H₇ClO₂

InChI: InChI=1/C8H7ClO2/c9-5-6-3-1-2-4-7(6)8(10)11/h1-4H,5H2,(H,10,11)

SMILES: c1ccc(c(c1)CCl)C(=O)O

Synonyms:

• Benzoic Acid, 2-(Chloromethyl)-
• 2-Chloromethylbenzoic acid
• o-Chloromethylbenzoic acid

2-(Chloromethyl)benzoic acid

CAS: 85888-81-9

2-(Chloromethyl)benzoic acid

Formula: C₈H₇ClO₂

Purity: 99%

Color and Shape: colourless to white. crystals / crystalline needles

Molecular weight: 170.59g/mol

Ref: 54-OR2330

2-(Chloromethyl)benzoic acid

CAS: 85888-81-9

Ref: 7W-GW5329

2-(Chloromethyl)benzoic acid

CAS: 85888-81-9

Formula: C₈H₇ClO₂

Purity: 98%

Color and Shape: Crystalline

Molecular weight: 170.59

Ref: 10-F078563

2-(Chloromethyl)benzoic acid

CAS: 85888-81-9

2-(Chloromethyl)benzoic acid (CMBA) is a reactive chemical that can be used as an oxidant or a carbanion. CMBA is activated by sulfinyl, alicyclic, and sulfoxides, which are organic compounds with one or more sulfur atoms. These reactions may be either alkylation or condensation reactions. The activated CMBA can then react with chlorine to form chlorinated products. This reaction can be catalyzed by low energy sources, such as light or heat.

Formula: C₈H₇ClO₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 170.59 g/mol

Ref: 3D-FC36693