CAS 858955-37-0
:Ethyl 6-amino-5-chloro-2-(4-chlorophenyl)pyrimidine-4-carboxylate
Description:
Ethyl 6-amino-5-chloro-2-(4-chlorophenyl)pyrimidine-4-carboxylate is a chemical compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing nitrogen atoms. This compound features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of amino and chloro substituents on the pyrimidine ring enhances its potential for biological activity, making it of interest in pharmaceutical research. The 4-chlorophenyl group attached to the pyrimidine structure may influence its interaction with biological targets, potentially affecting its pharmacokinetics and pharmacodynamics. The compound's molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, which are crucial for its biological efficacy. Additionally, the presence of multiple halogen atoms can impact its stability and reactivity, making it a candidate for further investigation in medicinal chemistry. Overall, this compound's unique structural features position it as a potentially valuable entity in drug development and related applications.
Formula:C13H11Cl2N3O2
InChI:InChI=1S/C13H11Cl2N3O2/c1-2-20-13(19)10-9(15)11(16)18-12(17-10)7-3-5-8(14)6-4-7/h3-6H,2H2,1H3,(H2,16,17,18)
SMILES:CCOC(=O)c1c(c(=N)nc(c2ccc(cc2)Cl)[nH]1)Cl
Synonyms:- Ethyl 6-amino-5-chloro-2-(4-chlorophenyl)-4-pyrimidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ethyl 6-amino-5-chloro-2-(4-chlorophenyl)pyrimidine-4-carboxylate
CAS:Formula:C13H11Cl2N3O2Molecular weight:312.1513
