CymitQuimica logo

CAS 858956-26-0

:

5-Chloro-2-cyclopropyl-1,6-dihydro-6-oxo-4-pyrimidinecarboxylic acid

Description:
5-Chloro-2-cyclopropyl-1,6-dihydro-6-oxo-4-pyrimidinecarboxylic acid is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a cyclopropyl group introduces a three-membered carbon ring, contributing to the compound's unique steric and electronic properties. The chloro substituent at the 5-position enhances the compound's reactivity and potential biological activity. The carboxylic acid functional group at the 4-position provides acidic characteristics, allowing for potential interactions in biological systems. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. The compound's stability, solubility, and reactivity can be influenced by the presence of the chloro and cyclopropyl groups, which may affect its interactions with other molecules. Overall, 5-Chloro-2-cyclopropyl-1,6-dihydro-6-oxo-4-pyrimidinecarboxylic acid represents a complex structure with potential utility in various chemical and pharmaceutical applications.
Formula:C8H7ClN2O3
InChI:InChI=1S/C8H7ClN2O3/c9-4-5(8(13)14)10-6(3-1-2-3)11-7(4)12/h3H,1-2H2,(H,13,14)(H,10,11,12)
InChI key:InChIKey=BFVDWJIMPJYKGH-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1NC(=NC(=O)C1Cl)C2CC2
Synonyms:
  • 5-Chloro-2-Cyclopropyl-1,6-dihydro-6-oxo-4-pyrimidinecarboxylic acid
  • 5-Chloro-2-cyclopropyl-1,6-dihydro-6-oxo-4-pyrimidinecarboxylic acid
  • 4-Pyrimidinecarboxylic acid, 5-chloro-2-cyclopropyl-1,6-dihydro-6-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.