
CAS 85896-15-7
:2-Chloro-N1-cyclohexyl-N1-methyl-1,4-benzenediamine
Description:
2-Chloro-N1-cyclohexyl-N1-methyl-1,4-benzenediamine, with the CAS number 85896-15-7, is an organic compound characterized by its aromatic structure and the presence of both amine and chloro functional groups. This compound features a cyclohexyl group and a methyl group attached to the nitrogen atoms of the diamine, contributing to its unique properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the chloro substituent can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the compound may have applications in the synthesis of dyes, pharmaceuticals, or agrochemicals due to its structural characteristics. Safety data should be consulted, as compounds with amine and chloro groups can pose health risks, including skin and respiratory irritation. Proper handling and storage conditions are essential to ensure safety when working with this substance.
Formula:C13H19ClN2
InChI:InChI=1S/C13H19ClN2/c1-16(11-5-3-2-4-6-11)13-8-7-10(15)9-12(13)14/h7-9,11H,2-6,15H2,1H3
InChI key:InChIKey=SZFJCDGNNBDKBT-UHFFFAOYSA-N
SMILES:N(C)(C1=C(Cl)C=C(N)C=C1)C2CCCCC2
Synonyms:- 2-Chloro-N1-cyclohexyl-N1-methyl-1,4-Benzenediamine
- 2-Chloro-1-N-cyclohexyl-1-N-methylbenzene-1,4-diamine
- 1,4-Benzenediamine, 2-chloro-N1-cyclohexyl-N1-methyl-
- 2-Chloro-N1-cyclohexyl-N1-methyl-1,4-benzenediamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.